Products 56920-74-2
CAS 56920-74-2 is the registry number for 3-(2-Bromo-4,5-methylenedioxyphenyl) propionic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(6-bromo-1,3-benzodioxol-5-yl)propanoic acid (CAS 56920-74-2) is a chemical compound with the molecular formula C10H9BrO4 and a molecular weight of 273.08 g/mol. IUPAC name: 3-(6-bromo-1,3-benzodioxol-5-yl)propanoic acid. InChIKey: URIRSTDHDAEDNP-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO4 |
|---|---|
| Molecular weight | 273.08 g/mol |
| IUPAC name | 3-(6-bromo-1,3-benzodioxol-5-yl)propanoic acid |
| InChIKey | URIRSTDHDAEDNP-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CCC(=O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
3-(2-Bromo-4,5-methylenedioxyphenyl)propionic acid, 3-(6-bromo-1,3-benzodioxol-5-yl)propanoic acid, 3-(2-BroMo-4,5-Methylenedioxyphenyl) propionic acid, 3-(6-Bromobenzo[d][1,3]dioxol-5-yl)propanoic acid, 3-(6-bromo-1,3-dioxaindan-5-yl)propanoic acid, 3-(2-Bromo-4,5-methylenedioxyphenyl)propionic acid, 97%