Products 2092700-62-2

CAS 2092700-62-2 is the registry number for Ethyl 5-bromobenzo[d][1,3]dioxole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 5-bromo-1,3-benzodioxole-4-carboxylate (CAS 2092700-62-2) is a chemical compound with the molecular formula C10H9BrO4 and a molecular weight of 273.08 g/mol. IUPAC name: ethyl 5-bromo-1,3-benzodioxole-4-carboxylate. InChIKey: HCWUXDJSOUTCRH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9BrO4
Molecular weight273.08 g/mol
IUPAC nameethyl 5-bromo-1,3-benzodioxole-4-carboxylate
InChIKeyHCWUXDJSOUTCRH-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C=CC2=C1OCO2)Br

Computed by PubChem (NCBI)