Products 1695118-73-0
CAS 1695118-73-0 is the registry number for 1-{((tert-Butoxy)carbonyl)(methyl)amino}-3-methoxycyclobutane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-methoxy-1-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclobutane-1-carboxylic acid (CAS 1695118-73-0) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 3-methoxy-1-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclobutane-1-carboxylic acid. InChIKey: FJFUTLPZZWGIIK-UHFFFAOYSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 3-methoxy-1-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclobutane-1-carboxylic acid |
| InChIKey | FJFUTLPZZWGIIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1(CC(C1)OC)C(=O)O |
Computed by PubChem (NCBI)