Products 1695292-51-3

CAS 1695292-51-3 is the registry number for 2-Cyclobutyl-2-({((9H-fluoren-9-yl)methoxy)carbonyl}amino)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-cyclobutyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 1695292-51-3) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: 2-cyclobutyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: TXLUWFPQLXODBP-UHFFFAOYSA-N.

Identity
Molecular formulaC21H21NO4
Molecular weight351.4 g/mol
IUPAC name2-cyclobutyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid
InChIKeyTXLUWFPQLXODBP-UHFFFAOYSA-N
SMILESC1CC(C1)C(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)