Products 1695359-94-4
CAS 1695359-94-4 is the registry number for 1-(4-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroethanone (CAS 1695359-94-4) is a chemical compound with the molecular formula C8H2BrClF4O and a molecular weight of 305.45 g/mol. IUPAC name: 1-(4-bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroethanone. InChIKey: YHJAXGCGUHHHOJ-UHFFFAOYSA-N.
| Molecular formula | C8H2BrClF4O |
|---|---|
| Molecular weight | 305.45 g/mol |
| IUPAC name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | YHJAXGCGUHHHOJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)C(F)(F)F)F)Cl)Br |
Computed by PubChem (NCBI)