Products 2918928-39-7
CAS 2918928-39-7 is the registry number for 1-(5-bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroethanone (CAS 2918928-39-7) is a chemical compound with the molecular formula C8H2BrClF4O and a molecular weight of 305.45 g/mol. IUPAC name: 1-(5-bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroethanone. InChIKey: XAFPXPQRUIMJJK-UHFFFAOYSA-N.
| Molecular formula | C8H2BrClF4O |
|---|---|
| Molecular weight | 305.45 g/mol |
| IUPAC name | 1-(5-bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | XAFPXPQRUIMJJK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)C(F)(F)F)F)Cl)Br |
Computed by PubChem (NCBI)