Products 1698813-17-0
CAS 1698813-17-0 is the registry number for 1-(3-bromo-2,6-difluorophenyl)-2-chloro-2,2-difluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-bromo-2,6-difluorophenyl)-2-chloro-2,2-difluoroethanone (CAS 1698813-17-0) is a chemical compound with the molecular formula C8H2BrClF4O and a molecular weight of 305.45 g/mol. IUPAC name: 1-(3-bromo-2,6-difluorophenyl)-2-chloro-2,2-difluoroethanone. InChIKey: SJALBNNWCDKBSC-UHFFFAOYSA-N.
| Molecular formula | C8H2BrClF4O |
|---|---|
| Molecular weight | 305.45 g/mol |
| IUPAC name | 1-(3-bromo-2,6-difluorophenyl)-2-chloro-2,2-difluoroethanone |
| InChIKey | SJALBNNWCDKBSC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)C(F)(F)Cl)F)Br |
Computed by PubChem (NCBI)