CAS 16964-21-9 is the registry number for 1,2-bis(6-methoxy-1h-benzimidazol-2-yl)ethane-1,2-diol, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
1,2-bis(6-methoxy-1H-benzimidazol-2-yl)ethane-1,2-diol (CAS 16964-21-9) is a chemical compound with the molecular formula C18H18N4O4 and a molecular weight of 354.4 g/mol. IUPAC name: 1,2-bis(6-methoxy-1H-benzimidazol-2-yl)ethane-1,2-diol. InChIKey: MZMNCFAGSTVAOQ-UHFFFAOYSA-N.
| Molecular formula | C18H18N4O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 1,2-bis(6-methoxy-1H-benzimidazol-2-yl)ethane-1,2-diol |
| InChIKey | MZMNCFAGSTVAOQ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(N2)C(C(C3=NC4=C(N3)C=C(C=C4)OC)O)O |
Computed by PubChem (NCBI)