Products 3056005-98-9

CAS 3056005-98-9 is the registry number for ALKBH1-IN-3 prodrug, 99.15%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg.

Structural formula: {0} (CAS {1})

Ethyl 1-[5-[(3-methoxyphenyl)methoxy]pyrimidin-2-yl]pyrazole-4-carboxylate (CAS 3056005-98-9) is a chemical compound with the molecular formula C18H18N4O4 and a molecular weight of 354.4 g/mol. IUPAC name: ethyl 1-[5-[(3-methoxyphenyl)methoxy]pyrimidin-2-yl]pyrazole-4-carboxylate. InChIKey: AHKNCCOBPODTQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18N4O4
Molecular weight354.4 g/mol
IUPAC nameethyl 1-[5-[(3-methoxyphenyl)methoxy]pyrimidin-2-yl]pyrazole-4-carboxylate
InChIKeyAHKNCCOBPODTQJ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN(N=C1)C2=NC=C(C=N2)OCC3=CC(=CC=C3)OC

Computed by PubChem (NCBI)

Synonyms: orb2665075