Products 77355-32-9
CAS 77355-32-9 is the registry number for 3,6-Bis(3,4-dimethoxyphenyl)-1,2,4,5-tetrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-bis(3,4-dimethoxyphenyl)-1,2,4,5-tetrazine (CAS 77355-32-9) is a chemical compound with the molecular formula C18H18N4O4 and a molecular weight of 354.4 g/mol. IUPAC name: 3,6-bis(3,4-dimethoxyphenyl)-1,2,4,5-tetrazine. InChIKey: QQBZMQDAHCNSHJ-UHFFFAOYSA-N.
| Molecular formula | C18H18N4O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 3,6-bis(3,4-dimethoxyphenyl)-1,2,4,5-tetrazine |
| InChIKey | QQBZMQDAHCNSHJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NN=C(N=N2)C3=CC(=C(C=C3)OC)OC)OC |
Computed by PubChem (NCBI)