Products 16964-49-1
CAS 16964-49-1 appears in our catalog under these names: (±)–9α–hydroxy Hexahydrocannabinol, (±)-9α-Hydroxy hexahydrocannabinol. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 500 μg, 1 mg.
(6aR,9S,10aR)-6,6,9-trimethyl-3-pentyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-1,9-diol (CAS 16964-49-1) is a chemical compound with the molecular formula C21H32O3 and a molecular weight of 332.5 g/mol. IUPAC name: (6aR,9S,10aR)-6,6,9-trimethyl-3-pentyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-1,9-diol. InChIKey: KSGRDIFQZVURIF-ZOCZFRKYSA-N.
| Molecular formula | C21H32O3 |
|---|---|
| Molecular weight | 332.5 g/mol |
| IUPAC name | (6aR,9S,10aR)-6,6,9-trimethyl-3-pentyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-1,9-diol |
| InChIKey | KSGRDIFQZVURIF-ZOCZFRKYSA-N |
| SMILES | CCCCCC1=CC(=C2[C@@H]3C[C@@](CC[C@H]3C(OC2=C1)(C)C)(C)O)O |
Computed by PubChem (NCBI)