Products 1696769-20-6
CAS 1696769-20-6 is the registry number for 2-(2-Bromo-5-methoxyphenyl)-2-(methylamino)acetamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2-bromo-5-methoxyphenyl)-2-(methylamino)acetamide (CAS 1696769-20-6) is a chemical compound with the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. IUPAC name: 2-(2-bromo-5-methoxyphenyl)-2-(methylamino)acetamide. InChIKey: RPVRUTJDVBUGOX-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 2-(2-bromo-5-methoxyphenyl)-2-(methylamino)acetamide |
| InChIKey | RPVRUTJDVBUGOX-UHFFFAOYSA-N |
| SMILES | CNC(C1=C(C=CC(=C1)OC)Br)C(=O)N |
Computed by PubChem (NCBI)