CAS 16969-11-2 is the registry number for Benzyltrimethylammonium acetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g.
Benzyl(trimethyl)azanium acetate (CAS 16969-11-2) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 209.28 g/mol. IUPAC name: benzyl(trimethyl)azanium acetate. InChIKey: FWYSSOIRLVHQNC-UHFFFAOYSA-M.
| Molecular formula | C12H19NO2 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | benzyl(trimethyl)azanium acetate |
| InChIKey | FWYSSOIRLVHQNC-UHFFFAOYSA-M |
| SMILES | CC(=O)[O-].C[N+](C)(C)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)