CAS 1697232-23-7 appears in our catalog under these names: 5-Methyl-1-(pyrimidin-5-yl)-1H-1,2,4-triazole-3-carboxylic acid, 95%, 95%, 5-Methyl-1-(pyrimidin-5-yl)-1H-1,2,4-triazole-3-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-methyl-1-pyrimidin-5-yl-1,2,4-triazole-3-carboxylic acid (CAS 1697232-23-7) is a chemical compound with the molecular formula C8H7N5O2 and a molecular weight of 205.17 g/mol. IUPAC name: 5-methyl-1-pyrimidin-5-yl-1,2,4-triazole-3-carboxylic acid. InChIKey: NOPYPCXLEGHLFF-UHFFFAOYSA-N.
| Molecular formula | C8H7N5O2 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 5-methyl-1-pyrimidin-5-yl-1,2,4-triazole-3-carboxylic acid |
| InChIKey | NOPYPCXLEGHLFF-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1C2=CN=CN=C2)C(=O)O |
Computed by PubChem (NCBI)