CAS 177595-29-8 is the registry number for 5-((2-Nitrophenyl)methyl)-1H-1,2,3,4-tetrazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-[(2-nitrophenyl)methyl]-2H-tetrazole (CAS 177595-29-8) is a chemical compound with the molecular formula C8H7N5O2 and a molecular weight of 205.17 g/mol. IUPAC name: 5-[(2-nitrophenyl)methyl]-2H-tetrazole. InChIKey: QTFPZDIGKYZDMI-UHFFFAOYSA-N.
| Molecular formula | C8H7N5O2 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 5-[(2-nitrophenyl)methyl]-2H-tetrazole |
| InChIKey | QTFPZDIGKYZDMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=NNN=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)