CAS 59301-20-1 is the registry number for 5-(3-Nitrophenyl)-4H-1,2,4-triazol-3-amine, 97%. Offered by: AmBeed. Available pack sizes: 10g.
5-(3-nitrophenyl)-1H-1,2,4-triazol-3-amine (CAS 59301-20-1) is a chemical compound with the molecular formula C8H7N5O2 and a molecular weight of 205.17 g/mol. IUPAC name: 5-(3-nitrophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: NTQPIRMIEKTLBR-UHFFFAOYSA-N.
| Molecular formula | C8H7N5O2 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 5-(3-nitrophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | NTQPIRMIEKTLBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NC(=NN2)N |
Computed by PubChem (NCBI)