CAS 59301-21-2 is the registry number for 3-(4-Nitrophenyl)-1H-1,2,4-triazol-5-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(4-nitrophenyl)-1H-1,2,4-triazol-3-amine (CAS 59301-21-2) is a chemical compound with the molecular formula C8H7N5O2 and a molecular weight of 205.17 g/mol. IUPAC name: 5-(4-nitrophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: VNQHSLZBEBYZHO-UHFFFAOYSA-N.
| Molecular formula | C8H7N5O2 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 5-(4-nitrophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | VNQHSLZBEBYZHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NN2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)