Products 1697321-54-2

CAS 1697321-54-2 is the registry number for 4-{1-((tert-Butoxy)carbonyl)azetidin-3-yl}butanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]butanoic acid (CAS 1697321-54-2) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]butanoic acid. InChIKey: KSKBTIBSNQGTKO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H21NO4
Molecular weight243.30 g/mol
IUPAC name4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]butanoic acid
InChIKeyKSKBTIBSNQGTKO-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC(C1)CCCC(=O)O

Computed by PubChem (NCBI)