Products 169736-93-0
CAS 169736-93-0 is the registry number for Angelol K. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 5mg.
[(1R,2S)-2,3-dihydroxy-1-(7-methoxy-2-oxochromen-6-yl)-3-methylbutyl] (Z)-2-methylbut-2-enoate (CAS 169736-93-0) is a chemical compound with the molecular formula C20H24O7 and a molecular weight of 376.4 g/mol. IUPAC name: [(1R,2S)-2,3-dihydroxy-1-(7-methoxy-2-oxochromen-6-yl)-3-methylbutyl] (Z)-2-methylbut-2-enoate. InChIKey: BAHUBXAYVOCLNA-PWZGUCPHSA-N.
| Molecular formula | C20H24O7 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | [(1R,2S)-2,3-dihydroxy-1-(7-methoxy-2-oxochromen-6-yl)-3-methylbutyl] (Z)-2-methylbut-2-enoate |
| InChIKey | BAHUBXAYVOCLNA-PWZGUCPHSA-N |
| SMILES | C/C=C(/C)\C(=O)O[C@H](C1=C(C=C2C(=C1)C=CC(=O)O2)OC)[C@@H](C(C)(C)O)O |
Computed by PubChem (NCBI)
Synonyms:
Angelol K, orb1684766