Products 83247-73-8
CAS 83247-73-8 is the registry number for Angelol H. Offered by: Biosynth, MedChemExpress. Available pack sizes: 50mg, 25mg, Get quote.
[(1R,2R)-2,3-dihydroxy-1-(7-methoxy-2-oxochromen-6-yl)-3-methylbutyl] (E)-2-methylbut-2-enoate (CAS 83247-73-8) is a chemical compound with the molecular formula C20H24O7 and a molecular weight of 376.4 g/mol. IUPAC name: [(1R,2R)-2,3-dihydroxy-1-(7-methoxy-2-oxochromen-6-yl)-3-methylbutyl] (E)-2-methylbut-2-enoate. InChIKey: BAHUBXAYVOCLNA-OEQDPHDDSA-N.
| Molecular formula | C20H24O7 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | [(1R,2R)-2,3-dihydroxy-1-(7-methoxy-2-oxochromen-6-yl)-3-methylbutyl] (E)-2-methylbut-2-enoate |
| InChIKey | BAHUBXAYVOCLNA-OEQDPHDDSA-N |
| SMILES | C/C=C(\C)/C(=O)O[C@H](C1=C(C=C2C(=C1)C=CC(=O)O2)OC)[C@H](C(C)(C)O)O |
Computed by PubChem (NCBI)
Synonyms:
Angelol H, orb1683158