Products 169772-44-5

CAS 169772-44-5 is the registry number for Rivastigmine Impurity 16. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-(3-methoxyphenyl)-N,N-dimethylethanamine (CAS 169772-44-5) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: 1-(3-methoxyphenyl)-N,N-dimethylethanamine. InChIKey: KFKCIWQNLGOHOA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO
Molecular weight179.26 g/mol
IUPAC name1-(3-methoxyphenyl)-N,N-dimethylethanamine
InChIKeyKFKCIWQNLGOHOA-UHFFFAOYSA-N
SMILESCC(C1=CC(=CC=C1)OC)N(C)C

Computed by PubChem (NCBI)