Products 889443-69-0
CAS 889443-69-0 appears in our catalog under these names: Rivastigmine EP Impurity F, (S)-1-(3-Methoxyphenyl)-N,N-dimethylethanamine, >95% (HPLC), (S)-1-(3-Methoxyphenyl)-N,N-dimethylethanamine 95%, (S)-1-(3-Methoxyphenyl)-N,N-Dimethylethanamine, 95%, 95%, Rivastigmine Hydrogen Tartrate EP Impurity F HCl. Offered by: Chemat Brand, TRC, Ambeed, Chemat. Available pack sizes: on request, 10mg, 25mg, 5mg, 50mg, 100mg, 250mg.
(1S)-1-(3-methoxyphenyl)-N,N-dimethylethanamine (CAS 889443-69-0) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: (1S)-1-(3-methoxyphenyl)-N,N-dimethylethanamine. InChIKey: KFKCIWQNLGOHOA-VIFPVBQESA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | (1S)-1-(3-methoxyphenyl)-N,N-dimethylethanamine |
| InChIKey | KFKCIWQNLGOHOA-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)OC)N(C)C |
Computed by PubChem (NCBI)
Synonyms:
(S)-1-(3-Methoxyphenyl)-N,N-dimethylethanamine, (1S)-1-(3-Methoxyphenyl)-N,N-dimethylethanamine, Rivastigmine EP Impurity F, 1-(3-Methoxyphenyl)-N,N-dimethylethanamine, (1S)-, S-(-)-[1-(3-methoxyphenyl)ethyl]-N,N-dimethylamine, Rivastigmine EP Imp F, Rivastigmine Impurity 3, Benzenemethanamine, 3-methoxy-N,N,alpha-trimethyl-, (alphaS)-, Rivastigmine hydrogen tartrate impurity F [EP], Rivastigmine Impurity F HCl