CAS 1698146-49-4 appears in our catalog under these names: 2-Amino-3-bromo-4-chlorobenzoic acid, 2-Amino-3-bromo-4-chlorobenzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
2-amino-3-bromo-4-chlorobenzoic acid (CAS 1698146-49-4) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 2-amino-3-bromo-4-chlorobenzoic acid. InChIKey: VHGUTMWHZMCGGV-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 2-amino-3-bromo-4-chlorobenzoic acid |
| InChIKey | VHGUTMWHZMCGGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)N)Br)Cl |
Computed by PubChem (NCBI)