Products 1698881-96-7

CAS 1698881-96-7 is the registry number for tert-Butyl 4-(2-oxo-2,3-dihydro-1H-1,3-benzodiazol-1-yl)benzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(2-oxo-3H-benzimidazol-1-yl)benzoate (CAS 1698881-96-7) is a chemical compound with the molecular formula C18H18N2O3 and a molecular weight of 310.3 g/mol. IUPAC name: tert-butyl 4-(2-oxo-3H-benzimidazol-1-yl)benzoate. InChIKey: WPVMUAVVINYWOD-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18N2O3
Molecular weight310.3 g/mol
IUPAC nametert-butyl 4-(2-oxo-3H-benzimidazol-1-yl)benzoate
InChIKeyWPVMUAVVINYWOD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=CC=C(C=C1)N2C3=CC=CC=C3NC2=O

Computed by PubChem (NCBI)