CAS 1698881-96-7 is the registry number for tert-Butyl 4-(2-oxo-2,3-dihydro-1H-1,3-benzodiazol-1-yl)benzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 4-(2-oxo-3H-benzimidazol-1-yl)benzoate (CAS 1698881-96-7) is a chemical compound with the molecular formula C18H18N2O3 and a molecular weight of 310.3 g/mol. IUPAC name: tert-butyl 4-(2-oxo-3H-benzimidazol-1-yl)benzoate. InChIKey: WPVMUAVVINYWOD-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O3 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | tert-butyl 4-(2-oxo-3H-benzimidazol-1-yl)benzoate |
| InChIKey | WPVMUAVVINYWOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)N2C3=CC=CC=C3NC2=O |
Computed by PubChem (NCBI)