CAS 1698953-35-3 is the registry number for 1-(2-Chlorobenzyl)-4-(chloromethyl)-1H-imidazole. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.
4-(chloromethyl)-1-[(2-chlorophenyl)methyl]imidazole (CAS 1698953-35-3) is a chemical compound with the molecular formula C11H10Cl2N2 and a molecular weight of 241.11 g/mol. IUPAC name: 4-(chloromethyl)-1-[(2-chlorophenyl)methyl]imidazole. InChIKey: CWQFRUHVUMKMRC-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 4-(chloromethyl)-1-[(2-chlorophenyl)methyl]imidazole |
| InChIKey | CWQFRUHVUMKMRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=C(N=C2)CCl)Cl |
Computed by PubChem (NCBI)