CAS 922510-77-8 is the registry number for 6,7-Dichloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dichloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole (CAS 922510-77-8) is a chemical compound with the molecular formula C11H10Cl2N2 and a molecular weight of 241.11 g/mol. IUPAC name: 6,7-dichloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole. InChIKey: SCXCCDOPSNWHMZ-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 6,7-dichloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| InChIKey | SCXCCDOPSNWHMZ-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1NC3=C2C=CC(=C3Cl)Cl |
Computed by PubChem (NCBI)