CAS 2768870-77-3 is the registry number for 2,4-Dichloro-7-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-7-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile (CAS 2768870-77-3) is a chemical compound with the molecular formula C11H10Cl2N2 and a molecular weight of 241.11 g/mol. IUPAC name: 2,4-dichloro-7-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile. InChIKey: KWBCZKYTQOAAJI-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 2,4-dichloro-7-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| InChIKey | KWBCZKYTQOAAJI-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)N=C(C(=C2Cl)C#N)Cl |
Computed by PubChem (NCBI)