CAS 1699998-81-6 is the registry number for N-Ethyl-4-hydroxy-n,2-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
N-ethyl-4-hydroxy-N,2-dimethylbenzamide (CAS 1699998-81-6) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: N-ethyl-4-hydroxy-N,2-dimethylbenzamide. InChIKey: DLONQLGDINRBAZ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | N-ethyl-4-hydroxy-N,2-dimethylbenzamide |
| InChIKey | DLONQLGDINRBAZ-UHFFFAOYSA-N |
| SMILES | CCN(C)C(=O)C1=C(C=C(C=C1)O)C |
Computed by PubChem (NCBI)