Products 1700368-87-1
CAS 1700368-87-1 is the registry number for 1-((tert-Butoxy)carbonyl)-3-cyclopropylpyrrolidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-cyclopropyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1700368-87-1) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 3-cyclopropyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: RHBCFKJGYYUWED-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 3-cyclopropyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | RHBCFKJGYYUWED-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)(C2CC2)C(=O)O |
Computed by PubChem (NCBI)