Products 1700657-87-9
CAS 1700657-87-9 is the registry number for nAChR modulator-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(6-chloro-3-pyridinyl)methyl]-[1,3,4]oxadiazolo[3,2-a]pyridin-4-ium-2-olate (CAS 1700657-87-9) is a chemical compound with the molecular formula C12H8ClN3O2 and a molecular weight of 261.66 g/mol. IUPAC name: 5-[(6-chloro-3-pyridinyl)methyl]-[1,3,4]oxadiazolo[3,2-a]pyridin-4-ium-2-olate. InChIKey: LRTBGGZYKCAJPA-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3O2 |
|---|---|
| Molecular weight | 261.66 g/mol |
| IUPAC name | 5-[(6-chloro-3-pyridinyl)methyl]-[1,3,4]oxadiazolo[3,2-a]pyridin-4-ium-2-olate |
| InChIKey | LRTBGGZYKCAJPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=[N+]2C(=C1)OC(=N2)[O-])CC3=CN=C(C=C3)Cl |
Computed by PubChem (NCBI)
Synonyms:
nAChR modulator-2, orb1982978