Products 1902218-84-1
CAS 1902218-84-1 is the registry number for nAChR modulator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(6-chloro-3-pyridinyl)methyl]-[1,2,4]oxadiazolo[2,3-a]pyridin-2-one (CAS 1902218-84-1) is a chemical compound with the molecular formula C12H8ClN3O2 and a molecular weight of 261.66 g/mol. IUPAC name: 5-[(6-chloro-3-pyridinyl)methyl]-[1,2,4]oxadiazolo[2,3-a]pyridin-2-one. InChIKey: XLNBIFIEQYDKBH-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3O2 |
|---|---|
| Molecular weight | 261.66 g/mol |
| IUPAC name | 5-[(6-chloro-3-pyridinyl)methyl]-[1,2,4]oxadiazolo[2,3-a]pyridin-2-one |
| InChIKey | XLNBIFIEQYDKBH-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=O)ON2C(=C1)CC3=CN=C(C=C3)Cl |
Computed by PubChem (NCBI)
Synonyms:
nAChR modulator-1, orb1982979