CAS 170147-76-9 appears in our catalog under these names: N-Boc-5-hydroxyindoline, 97%, N–Boc–5–Hydroxyindoline, N-Boc-5-Hydroxyindoline 96%, N-Boc-5-Hydroxyindoline, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g, 100mg, 500mg, 10g.
Tert-butyl 5-hydroxy-2,3-dihydroindole-1-carboxylate (CAS 170147-76-9) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: tert-butyl 5-hydroxy-2,3-dihydroindole-1-carboxylate. InChIKey: BKEDNSDALWZCGF-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | tert-butyl 5-hydroxy-2,3-dihydroindole-1-carboxylate |
| InChIKey | BKEDNSDALWZCGF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C=CC(=C2)O |
Computed by PubChem (NCBI)