Products 1701637-09-3
CAS 1701637-09-3 is the registry number for 4-(4-bromo-3-chloro-2-fluorophenyl)tetrahydro-2H-pyran-4-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(4-bromo-3-chloro-2-fluorophenyl)oxan-4-ol (CAS 1701637-09-3) is a chemical compound with the molecular formula C11H11BrClFO2 and a molecular weight of 309.56 g/mol. IUPAC name: 4-(4-bromo-3-chloro-2-fluorophenyl)oxan-4-ol. InChIKey: RSHODGFYVIQVRW-UHFFFAOYSA-N.
| Molecular formula | C11H11BrClFO2 |
|---|---|
| Molecular weight | 309.56 g/mol |
| IUPAC name | 4-(4-bromo-3-chloro-2-fluorophenyl)oxan-4-ol |
| InChIKey | RSHODGFYVIQVRW-UHFFFAOYSA-N |
| SMILES | C1COCCC1(C2=C(C(=C(C=C2)Br)Cl)F)O |
Computed by PubChem (NCBI)