CAS 1898314-77-6 is the registry number for 3-(2-Bromo-4-chloro-3-fluorophenyl)-2,2-dimethylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-bromo-4-chloro-3-fluorophenyl)-2,2-dimethylpropanoic acid (CAS 1898314-77-6) is a chemical compound with the molecular formula C11H11BrClFO2 and a molecular weight of 309.56 g/mol. IUPAC name: 3-(2-bromo-4-chloro-3-fluorophenyl)-2,2-dimethylpropanoic acid. InChIKey: POCXHVZFLMEANW-UHFFFAOYSA-N.
| Molecular formula | C11H11BrClFO2 |
|---|---|
| Molecular weight | 309.56 g/mol |
| IUPAC name | 3-(2-bromo-4-chloro-3-fluorophenyl)-2,2-dimethylpropanoic acid |
| InChIKey | POCXHVZFLMEANW-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=C(C(=C(C=C1)Cl)F)Br)C(=O)O |
Computed by PubChem (NCBI)