CAS 2484888-82-4 is the registry number for tert-Butyl 5-bromo-3-chloro-2-fluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
Tert-butyl 5-bromo-3-chloro-2-fluorobenzoate (CAS 2484888-82-4) is a chemical compound with the molecular formula C11H11BrClFO2 and a molecular weight of 309.56 g/mol. IUPAC name: tert-butyl 5-bromo-3-chloro-2-fluorobenzoate. InChIKey: QALIEJRDTWHIMG-UHFFFAOYSA-N.
| Molecular formula | C11H11BrClFO2 |
|---|---|
| Molecular weight | 309.56 g/mol |
| IUPAC name | tert-butyl 5-bromo-3-chloro-2-fluorobenzoate |
| InChIKey | QALIEJRDTWHIMG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=CC(=C1)Br)Cl)F |
Computed by PubChem (NCBI)