CAS 170210-46-5 is the registry number for Ketoconazole Impurity 41. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,4S)-2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate (CAS 170210-46-5) is a chemical compound with the molecular formula C18H15BrCl2O4 and a molecular weight of 446.1 g/mol. IUPAC name: [(2S,4S)-2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate. InChIKey: OXUPOIXSQGXRGF-RDTXWAMCSA-N.
| Molecular formula | C18H15BrCl2O4 |
|---|---|
| Molecular weight | 446.1 g/mol |
| IUPAC name | [(2S,4S)-2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate |
| InChIKey | OXUPOIXSQGXRGF-RDTXWAMCSA-N |
| SMILES | C1[C@H](O[C@](O1)(CBr)C2=C(C=C(C=C2)Cl)Cl)COC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)