Products 769121-73-5
CAS 769121-73-5 appears in our catalog under these names: Ketoconazole Impurity 42, Ketoconazole Impurity 41, Itraconazole Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,4R)-2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate (CAS 769121-73-5) is a chemical compound with the molecular formula C18H15BrCl2O4 and a molecular weight of 446.1 g/mol. IUPAC name: [(2S,4R)-2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate. InChIKey: OXUPOIXSQGXRGF-KBXCAEBGSA-N.
| Molecular formula | C18H15BrCl2O4 |
|---|---|
| Molecular weight | 446.1 g/mol |
| IUPAC name | [(2S,4R)-2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate |
| InChIKey | OXUPOIXSQGXRGF-KBXCAEBGSA-N |
| SMILES | C1[C@@H](O[C@](O1)(CBr)C2=C(C=C(C=C2)Cl)Cl)COC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)