CAS 61397-57-7 appears in our catalog under these names: Itraconazole Impurity 29, trans-(2-Bromomethyl-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl)methyl Benzoate, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg, 50mg.
[(2R,4R)-2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate (CAS 61397-57-7) is a chemical compound with the molecular formula C18H15BrCl2O4 and a molecular weight of 446.1 g/mol. IUPAC name: [(2R,4R)-2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate. InChIKey: OXUPOIXSQGXRGF-KSSFIOAISA-N.
| Molecular formula | C18H15BrCl2O4 |
|---|---|
| Molecular weight | 446.1 g/mol |
| IUPAC name | [(2R,4R)-2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate |
| InChIKey | OXUPOIXSQGXRGF-KSSFIOAISA-N |
| SMILES | C1[C@@H](O[C@@](O1)(CBr)C2=C(C=C(C=C2)Cl)Cl)COC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)