Products 1702668-54-9
CAS 1702668-54-9 is the registry number for rac 7,14-Dihydroxy Efavirenz, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.
6-chloro-7-hydroxy-4-[2-(1-hydroxycyclopropyl)ethynyl]-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (CAS 1702668-54-9) is a chemical compound with the molecular formula C14H9ClF3NO4 and a molecular weight of 347.67 g/mol. IUPAC name: 6-chloro-7-hydroxy-4-[2-(1-hydroxycyclopropyl)ethynyl]-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one. InChIKey: KUTVEJICWJIROD-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF3NO4 |
|---|---|
| Molecular weight | 347.67 g/mol |
| IUPAC name | 6-chloro-7-hydroxy-4-[2-(1-hydroxycyclopropyl)ethynyl]-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| InChIKey | KUTVEJICWJIROD-UHFFFAOYSA-N |
| SMILES | C1CC1(C#CC2(C3=CC(=C(C=C3NC(=O)O2)O)Cl)C(F)(F)F)O |
Computed by PubChem (NCBI)
Synonyms:
rac 7,14-Dihydroxy Efavirenz