Products 252343-27-4
CAS 252343-27-4 appears in our catalog under these names: Efavirenz Impurity 15(8,14-Dihydroxy Efavirenz), (S)-8,14-Dihydroxy Efavirenz, >95% (HPLC), (S)-8,14-Dihydroxy efavirenz. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
(4S)-6-chloro-8-hydroxy-4-[2-(1-hydroxycyclopropyl)ethynyl]-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (CAS 252343-27-4) is a chemical compound with the molecular formula C14H9ClF3NO4 and a molecular weight of 347.67 g/mol. IUPAC name: (4S)-6-chloro-8-hydroxy-4-[2-(1-hydroxycyclopropyl)ethynyl]-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one. InChIKey: WILFXLMJFSKQRP-ZDUSSCGKSA-N.
| Molecular formula | C14H9ClF3NO4 |
|---|---|
| Molecular weight | 347.67 g/mol |
| IUPAC name | (4S)-6-chloro-8-hydroxy-4-[2-(1-hydroxycyclopropyl)ethynyl]-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| InChIKey | WILFXLMJFSKQRP-ZDUSSCGKSA-N |
| SMILES | C1CC1(C#C[C@]2(C3=C(C(=CC(=C3)Cl)O)NC(=O)O2)C(F)(F)F)O |
Computed by PubChem (NCBI)