Products 42874-02-2
CAS 42874-02-2 is the registry number for Oxyfluorfen Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1-(3-methoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene (CAS 42874-02-2) is a chemical compound with the molecular formula C14H9ClF3NO4 and a molecular weight of 347.67 g/mol. IUPAC name: 2-chloro-1-(3-methoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene. InChIKey: APSLKXCDORFAIZ-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF3NO4 |
|---|---|
| Molecular weight | 347.67 g/mol |
| IUPAC name | 2-chloro-1-(3-methoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene |
| InChIKey | APSLKXCDORFAIZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)OC2=C(C=C(C=C2)C(F)(F)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)