CAS 1702694-74-3 is the registry number for 2-(3-Bromo-4-methylphenyl)-5-methyl-1H-imidazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-bromo-4-methylphenyl)-5-methyl-1H-imidazole (CAS 1702694-74-3) is a chemical compound with the molecular formula C11H11BrN2 and a molecular weight of 251.12 g/mol. IUPAC name: 2-(3-bromo-4-methylphenyl)-5-methyl-1H-imidazole. InChIKey: KOAGLHFBMXTWHX-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2 |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 2-(3-bromo-4-methylphenyl)-5-methyl-1H-imidazole |
| InChIKey | KOAGLHFBMXTWHX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NC=C(N2)C)Br |
Computed by PubChem (NCBI)