CAS 170277-50-6 is the registry number for 2-Benzyl-3-phenyloxirane, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-benzyl-3-phenyloxirane (CAS 170277-50-6) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: 2-benzyl-3-phenyloxirane. InChIKey: ZMEQMWLSJBXCMR-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 2-benzyl-3-phenyloxirane |
| InChIKey | ZMEQMWLSJBXCMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2C(O2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)