Products 170384-81-3
CAS 170384-81-3 appears in our catalog under these names: Zedoalactone B, Zedoalactone B, ≥95%. Offered by: MedChemExpress, Chemat. Available pack sizes: 5 mg, 1 mg, 5mg.
(5R,5aR,8S,8aR)-5,5a,8-trihydroxy-1,5,8-trimethyl-6,7,8a,9-tetrahydroazuleno[6,5-b]furan-2-one (CAS 170384-81-3) is a chemical compound with the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. IUPAC name: (5R,5aR,8S,8aR)-5,5a,8-trihydroxy-1,5,8-trimethyl-6,7,8a,9-tetrahydroazuleno[6,5-b]furan-2-one. InChIKey: HPNXJLIPUVXDNH-FAAHXZRKSA-N.
| Molecular formula | C15H20O5 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | (5R,5aR,8S,8aR)-5,5a,8-trihydroxy-1,5,8-trimethyl-6,7,8a,9-tetrahydroazuleno[6,5-b]furan-2-one |
| InChIKey | HPNXJLIPUVXDNH-FAAHXZRKSA-N |
| SMILES | CC1=C2C[C@@H]3[C@@](CC[C@@]3([C@](C=C2OC1=O)(C)O)O)(C)O |
Computed by PubChem (NCBI)
Synonyms:
ZEDOALACTONE B, orb1991212