CAS 1703875-85-7 is the registry number for (S)-1-(3-Bromo-5-(trifluoromethoxy)phenyl)butan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[3-bromo-5-(trifluoromethoxy)phenyl]butan-1-amine (CAS 1703875-85-7) is a chemical compound with the molecular formula C11H13BrF3NO and a molecular weight of 312.13 g/mol. IUPAC name: (1S)-1-[3-bromo-5-(trifluoromethoxy)phenyl]butan-1-amine. InChIKey: LENICKSGYCQAGD-JTQLQIEISA-N.
| Molecular formula | C11H13BrF3NO |
|---|---|
| Molecular weight | 312.13 g/mol |
| IUPAC name | (1S)-1-[3-bromo-5-(trifluoromethoxy)phenyl]butan-1-amine |
| InChIKey | LENICKSGYCQAGD-JTQLQIEISA-N |
| SMILES | CCC[C@@H](C1=CC(=CC(=C1)Br)OC(F)(F)F)N |
Computed by PubChem (NCBI)