CAS 2270907-24-7 is the registry number for 1-[5-Bromo-2-(2,2,2-trifluoro-ethoxy)-phenyl]-propylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]propan-1-amine (CAS 2270907-24-7) is a chemical compound with the molecular formula C11H13BrF3NO and a molecular weight of 312.13 g/mol. IUPAC name: 1-[5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]propan-1-amine. InChIKey: AYJOLQXNOKICEN-UHFFFAOYSA-N.
| Molecular formula | C11H13BrF3NO |
|---|---|
| Molecular weight | 312.13 g/mol |
| IUPAC name | 1-[5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]propan-1-amine |
| InChIKey | AYJOLQXNOKICEN-UHFFFAOYSA-N |
| SMILES | CCC(C1=C(C=CC(=C1)Br)OCC(F)(F)F)N |
Computed by PubChem (NCBI)