Products 2270911-30-1
CAS 2270911-30-1 is the registry number for (5-Bromo-2-trifluoromethoxy-benzyl)-isopropyl-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-[[5-bromo-2-(trifluoromethoxy)phenyl]methyl]propan-2-amine (CAS 2270911-30-1) is a chemical compound with the molecular formula C11H13BrF3NO and a molecular weight of 312.13 g/mol. IUPAC name: N-[[5-bromo-2-(trifluoromethoxy)phenyl]methyl]propan-2-amine. InChIKey: TUCFTKUXDVNAHL-UHFFFAOYSA-N.
| Molecular formula | C11H13BrF3NO |
|---|---|
| Molecular weight | 312.13 g/mol |
| IUPAC name | N-[[5-bromo-2-(trifluoromethoxy)phenyl]methyl]propan-2-amine |
| InChIKey | TUCFTKUXDVNAHL-UHFFFAOYSA-N |
| SMILES | CC(C)NCC1=C(C=CC(=C1)Br)OC(F)(F)F |
Computed by PubChem (NCBI)