CAS 1704063-59-1 is the registry number for (3–((4–Methylpiperazin–1–yl)sulfonyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[3-(4-methylpiperazin-1-yl)sulfonylphenyl]boronic acid (CAS 1704063-59-1) is a chemical compound with the molecular formula C11H17BN2O4S and a molecular weight of 284.14 g/mol. IUPAC name: [3-(4-methylpiperazin-1-yl)sulfonylphenyl]boronic acid. InChIKey: ZLXQUGXUIZMDPU-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O4S |
|---|---|
| Molecular weight | 284.14 g/mol |
| IUPAC name | [3-(4-methylpiperazin-1-yl)sulfonylphenyl]boronic acid |
| InChIKey | ZLXQUGXUIZMDPU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)S(=O)(=O)N2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)