CAS 486422-11-1 appears in our catalog under these names: 4-(4-Methyl-piperazinesulfonyl)phenyl boronic acid, 96%, (4-((4-Methylpiperazin-1-yl)sulfonyl)phenyl)boronic acid, 95-<97%, (4-((4-Methylpiperazin-1-yl)sulfonyl)phenyl)boronic acid, ≥97-<99%, (4-((4-Methylpiperazin-1-yl)sulfonyl)phenyl)boronic acid, 98%, (4–((4–Methyl–1–piperazinyl)sulfonyl)phenyl)boronic acid. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 100mg, 250mg.
[4-(4-methylpiperazin-1-yl)sulfonylphenyl]boronic acid (CAS 486422-11-1) is a chemical compound with the molecular formula C11H17BN2O4S and a molecular weight of 284.14 g/mol. IUPAC name: [4-(4-methylpiperazin-1-yl)sulfonylphenyl]boronic acid. InChIKey: WTIRVOVQNGLJIQ-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O4S |
|---|---|
| Molecular weight | 284.14 g/mol |
| IUPAC name | [4-(4-methylpiperazin-1-yl)sulfonylphenyl]boronic acid |
| InChIKey | WTIRVOVQNGLJIQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)