CAS 1704122-13-3 is the registry number for (2–Methyl–5–(piperazin–1–ylsulfonyl) phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
(2-methyl-5-piperazin-1-ylsulfonylphenyl)boronic acid (CAS 1704122-13-3) is a chemical compound with the molecular formula C11H17BN2O4S and a molecular weight of 284.14 g/mol. IUPAC name: (2-methyl-5-piperazin-1-ylsulfonylphenyl)boronic acid. InChIKey: STXXDFPCUCKAFQ-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O4S |
|---|---|
| Molecular weight | 284.14 g/mol |
| IUPAC name | (2-methyl-5-piperazin-1-ylsulfonylphenyl)boronic acid |
| InChIKey | STXXDFPCUCKAFQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)S(=O)(=O)N2CCNCC2)C)(O)O |
Computed by PubChem (NCBI)